C15H17N2NaO3S3 — CID 88794523
sodium (2R,5R)-3,3,6-trimethyl-7-oxo-6-[(2-thiophen-2-ylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carbothioate (PubChem CID 88794523) has the molecular formula C15H17N2NaO3S3 and a molecular weight of 392.50 g/mol. Its IUPAC name is sodium (2R,5R)-3,3,6-trimethyl-7-oxo-6-[(2-thiophen-2-ylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carbothioate.
| Compound Name | sodium (2R,5R)-3,3,6-trimethyl-7-oxo-6-[(2-thiophen-2-ylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carbothioate |
|---|---|
| PubChem CID | 88794523 |
| Molecular Formula | C15H17N2NaO3S3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | sodium (2R,5R)-3,3,6-trimethyl-7-oxo-6-[(2-thiophen-2-ylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carbothioate |
| SMILES | CC1(C)S[C@H]2N(C(=O)C2(C)NC(=O)Cc2cccs2)[C@H]1C(=O)[S-].[Na+] |
| InChI | InChI=1S/C15H18N2O3S3.Na/c1-14(2)10(11(19)21)17-12(20)15(3,13(17)23-14)16-9(18)7-8-5-4-6-22-8;/h4-6,10,13H,7H2,1-3H3,(H,16,18)(H,19,21);/q;+1/p-1/t10-,13+,15?;/m0./s1 |
| InChIKey | YOTFLLXTMKFPSY-STYOXZNPSA-M |
| XLogP | -1.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|