C24H34N2O6S — CID 22802169
(2S,5R,6S)-6-[(2,6-dibutoxybenzoyl)amino]-3,3,6-trimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 22802169) has the molecular formula C24H34N2O6S and a molecular weight of 478.61 g/mol. Its IUPAC name is (2S,5R,6S)-6-[(2,6-dibutoxybenzoyl)amino]-3,3,6-trimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6S)-6-[(2,6-dibutoxybenzoyl)amino]-3,3,6-trimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 22802169 |
| Molecular Formula | C24H34N2O6S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (2S,5R,6S)-6-[(2,6-dibutoxybenzoyl)amino]-3,3,6-trimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CCCCOc1cccc(OCCCC)c1C(=O)N[C@@]1(C)C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@@H]21 |
| InChI | InChI=1S/C24H34N2O6S/c1-6-8-13-31-15-11-10-12-16(32-14-9-7-2)17(15)19(27)25-24(5)21(30)26-18(20(28)29)23(3,4)33-22(24)26/h10-12,18,22H,6-9,13-14H2,1-5H3,(H,25,27)(H,28,29)/t18-,22+,24-/m0/s1 |
| InChIKey | FHCDSOYLXABWTE-ANJVHQHFSA-N |
| XLogP | 3.68 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|