C27H38N2O7S — CID 22790999
(2S,5R,6S)-6-acetyl-6-[2-(2-methoxyphenoxy)decanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 22790999) has the molecular formula C27H38N2O7S and a molecular weight of 534.68 g/mol. Its IUPAC name is (2S,5R,6S)-6-acetyl-6-[2-(2-methoxyphenoxy)decanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6S)-6-acetyl-6-[2-(2-methoxyphenoxy)decanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 22790999 |
| Molecular Formula | C27H38N2O7S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (2S,5R,6S)-6-acetyl-6-[2-(2-methoxyphenoxy)decanoylamino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CCCCCCCCC(Oc1ccccc1OC)C(=O)N[C@@]1(C(C)=O)C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@@H]21 |
| InChI | InChI=1S/C27H38N2O7S/c1-6-7-8-9-10-11-16-20(36-19-15-13-12-14-18(19)35-5)22(31)28-27(17(2)30)24(34)29-21(23(32)33)26(3,4)37-25(27)29/h12-15,20-21,25H,6-11,16H2,1-5H3,(H,28,31)(H,32,33)/t20?,21-,25+,27-/m0/s1 |
| InChIKey | WPCXVQBYWKPXAU-XIBQAUCFSA-N |
| XLogP | 3.78 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|