C15H16N4O7S — CID 54191336
(2S,5R,6R)-3,3-dimethyl-6-[[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 54191336) has the molecular formula C15H16N4O7S and a molecular weight of 396.38 g/mol. Its IUPAC name is (2S,5R,6R)-3,3-dimethyl-6-[[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-3,3-dimethyl-6-[[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 54191336 |
| Molecular Formula | C15H16N4O7S |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | (2S,5R,6R)-3,3-dimethyl-6-[[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]amino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)Cn3cc([N+](=O)[O-])ccc3=O)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C15H16N4O7S/c1-15(2)11(14(23)24)18-12(22)10(13(18)27-15)16-8(20)6-17-5-7(19(25)26)3-4-9(17)21/h3-5,10-11,13H,6H2,1-2H3,(H,16,20)(H,23,24)/t10-,11+,13-/m1/s1 |
| InChIKey | PISWESSTQZFUID-NTZNESFSSA-N |
| XLogP | -0.61 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|