C16H28N2O4SSi — CID 23266708
3,3-dimethyl-7-oxo-6-[(2-triethylsilylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 23266708) has the molecular formula C16H28N2O4SSi and a molecular weight of 372.56 g/mol. Its IUPAC name is 3,3-dimethyl-7-oxo-6-[(2-triethylsilylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | 3,3-dimethyl-7-oxo-6-[(2-triethylsilylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 23266708 |
| Molecular Formula | C16H28N2O4SSi |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3,3-dimethyl-7-oxo-6-[(2-triethylsilylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC[Si](CC)(CC)CC(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O |
| InChI | InChI=1S/C16H28N2O4SSi/c1-6-24(7-2,8-3)9-10(19)17-11-13(20)18-12(15(21)22)16(4,5)23-14(11)18/h11-12,14H,6-9H2,1-5H3,(H,17,19)(H,21,22) |
| InChIKey | JIUJESYDTRDOEQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|