C14H18N4O5S — CID 54536064
(2S,5R,6R)-6-[[2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 54536064) has the molecular formula C14H18N4O5S and a molecular weight of 354.39 g/mol. Its IUPAC name is (2S,5R,6R)-6-[[2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-[[2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 54536064 |
| Molecular Formula | C14H18N4O5S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (2S,5R,6R)-6-[[2-(3-ethyl-1,2,4-oxadiazol-5-yl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CCc1noc(CC(=O)N[C@@H]2C(=O)N3[C@@H]2SC(C)(C)[C@@H]3C(=O)O)n1 |
| InChI | InChI=1S/C14H18N4O5S/c1-4-6-15-8(23-17-6)5-7(19)16-9-11(20)18-10(13(21)22)14(2,3)24-12(9)18/h9-10,12H,4-5H2,1-3H3,(H,16,19)(H,21,22)/t9-,10+,12-/m1/s1 |
| InChIKey | YZVZJBPPFLZZOL-JFGNBEQYSA-N |
| XLogP | -0.19 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |