C16H17KN3O7S — CID 6331714
CID 6331714 (PubChem CID 6331714) has the molecular formula C16H17KN3O7S and a molecular weight of 434.49 g/mol.
| Compound Name | CID 6331714 |
|---|---|
| PubChem CID | 6331714 |
| Molecular Formula | C16H17KN3O7S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | — |
| SMILES | CC1(C)SC2C(NC(=O)COc3ccc([N+](=O)[O-])cc3)C(=O)N2C1C(=O)O.[K] |
| InChI | InChI=1S/C16H17N3O7S.K/c1-16(2)12(15(22)23)18-13(21)11(14(18)27-16)17-10(20)7-26-9-5-3-8(4-6-9)19(24)25;/h3-6,11-12,14H,7H2,1-2H3,(H,17,20)(H,22,23); |
| InChIKey | YZOABXPTHGNFCY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|