C17H14N2O6S — CID 7280907
(2R,4S)-2-[4-(4-nitrobenzoyl)oxyphenyl]-1,3-thiazolidin-3-ium-4-carboxylate (PubChem CID 7280907) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is (2R,4S)-2-[4-(4-nitrobenzoyl)oxyphenyl]-1,3-thiazolidin-3-ium-4-carboxylate.
| Compound Name | (2R,4S)-2-[4-(4-nitrobenzoyl)oxyphenyl]-1,3-thiazolidin-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 7280907 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (2R,4S)-2-[4-(4-nitrobenzoyl)oxyphenyl]-1,3-thiazolidin-3-ium-4-carboxylate |
| SMILES | O=C(Oc1ccc([C@@H]2[NH2+][C@@H](C(=O)[O-])CS2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H14N2O6S/c20-16(21)14-9-26-15(18-14)10-3-7-13(8-4-10)25-17(22)11-1-5-12(6-2-11)19(23)24/h1-8,14-15,18H,9H2,(H,20,21)/t14-,15-/m1/s1 |
| InChIKey | CCTDWUJMYXFBBE-HUUCEWRRSA-N |
| XLogP | 0.24 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|