C16H13NO6 — CID 57236500
[4-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]phenyl] 4-nitrobenzoate (PubChem CID 57236500) has the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. Its IUPAC name is [4-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 57236500 |
| Molecular Formula | C16H13NO6 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | [4-[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]phenyl] 4-nitrobenzoate |
| SMILES | O=C(Oc1ccc([C@@H]2O[C@H]2CO)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H13NO6/c18-9-14-15(23-14)10-3-7-13(8-4-10)22-16(19)11-1-5-12(6-2-11)17(20)21/h1-8,14-15,18H,9H2/t14-,15-/m0/s1 |
| InChIKey | LPEOQGIWOXCYDY-GJZGRUSLSA-N |
| XLogP | 2.25 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|