C9H9NO4 — CID 15678237
[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanol (PubChem CID 15678237) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is [(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanol.
| Compound Name | [(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 15678237 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | [(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc([C@H]2O[C@H]2CO)cc1 |
| InChI | InChI=1S/C9H9NO4/c11-5-8-9(14-8)6-1-3-7(4-2-6)10(12)13/h1-4,8-9,11H,5H2/t8-,9+/m0/s1 |
| InChIKey | TVWSYFXHQPGITR-DTWKUNHWSA-N |
| XLogP | 1.03 |
| TPSA | 75.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|