C12H14NO8- — CID 21115851
(2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(4-nitrophenoxy)oxan-2-olate (PubChem CID 21115851) has the molecular formula C12H14NO8- and a molecular weight of 300.24 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(4-nitrophenoxy)oxan-2-olate.
| Compound Name | (2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(4-nitrophenoxy)oxan-2-olate |
|---|---|
| PubChem CID | 21115851 |
| Molecular Formula | C12H14NO8- |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (2S,3S,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(4-nitrophenoxy)oxan-2-olate |
| SMILES | O=[N+]([O-])c1ccc(O[C@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2[O-])cc1 |
| InChI | InChI=1S/C12H14NO8/c14-5-8-9(15)10(16)11(12(17)21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-16H,5H2/q-1/t8-,9-,10+,11+,12+/m1/s1 |
| InChIKey | VRANHXKHYNYKBN-GCHJQGSQSA-N |
| XLogP | -1.86 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|