C12H15NO7S — CID 87814818
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-5-(4-nitrophenoxy)-6-sulfanyloxane-3,4-diol (PubChem CID 87814818) has the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-5-(4-nitrophenoxy)-6-sulfanyloxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-5-(4-nitrophenoxy)-6-sulfanyloxane-3,4-diol |
|---|---|
| PubChem CID | 87814818 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-5-(4-nitrophenoxy)-6-sulfanyloxane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(O[C@@H]2[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]2S)cc1 |
| InChI | InChI=1S/C12H15NO7S/c14-5-8-9(15)10(16)11(12(21)20-8)19-7-3-1-6(2-4-7)13(17)18/h1-4,8-12,14-16,21H,5H2/t8-,9+,10+,11-,12+/m1/s1 |
| InChIKey | JKTHZUFHLMFARE-IIRVCBMXSA-N |
| XLogP | -0.29 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|