C16H24O5S — CID 87814878
(2R,3R,4S,5R,6S)-5-(4-tert-butylphenoxy)-2-(hydroxymethyl)-6-sulfanyloxane-3,4-diol (PubChem CID 87814878) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-5-(4-tert-butylphenoxy)-2-(hydroxymethyl)-6-sulfanyloxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-5-(4-tert-butylphenoxy)-2-(hydroxymethyl)-6-sulfanyloxane-3,4-diol |
|---|---|
| PubChem CID | 87814878 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2R,3R,4S,5R,6S)-5-(4-tert-butylphenoxy)-2-(hydroxymethyl)-6-sulfanyloxane-3,4-diol |
| SMILES | CC(C)(C)c1ccc(O[C@@H]2[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]2S)cc1 |
| InChI | InChI=1S/C16H24O5S/c1-16(2,3)9-4-6-10(7-5-9)20-14-13(19)12(18)11(8-17)21-15(14)22/h4-7,11-15,17-19,22H,8H2,1-3H3/t11-,12+,13+,14-,15+/m1/s1 |
| InChIKey | GZFDKIGPLBBAMM-FQKPHLNHSA-N |
| XLogP | 1.10 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|