C16H24O5S — CID 69404202
(2S,3R,4S,5R,6R)-2-(4-tert-butylphenyl)sulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 69404202) has the molecular formula C16H24O5S and a molecular weight of 328.43 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-(4-tert-butylphenyl)sulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-(4-tert-butylphenyl)sulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 69404202 |
| Molecular Formula | C16H24O5S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-(4-tert-butylphenyl)sulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)(C)c1ccc(S[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C16H24O5S/c1-16(2,3)9-4-6-10(7-5-9)22-15-14(20)13(19)12(18)11(8-17)21-15/h4-7,11-15,17-20H,8H2,1-3H3/t11-,12+,13+,14-,15+/m1/s1 |
| InChIKey | WMAALEARWSOWCZ-FQKPHLNHSA-N |
| XLogP | 0.88 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |