C16H24O7 — CID 3830523
2-(4-butoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 3830523) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-(4-butoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-(4-butoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 3830523 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-(4-butoxyphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCOc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C16H24O7/c1-2-3-8-21-10-4-6-11(7-5-10)22-16-15(20)14(19)13(18)12(9-17)23-16/h4-7,12-20H,2-3,8-9H2,1H3 |
| InChIKey | NHCXMQMPGMCJOZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|