C17H24O7 — CID 71765866
1-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pentan-1-one (PubChem CID 71765866) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is 1-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pentan-1-one.
| Compound Name | 1-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pentan-1-one |
|---|---|
| PubChem CID | 71765866 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-[4-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pentan-1-one |
| SMILES | CCCCC(=O)c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C17H24O7/c1-2-3-4-12(19)10-5-7-11(8-6-10)23-17-16(22)15(21)14(20)13(9-18)24-17/h5-8,13-18,20-22H,2-4,9H2,1H3/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | GOKAZXCYXDNAGD-WRQOLXDDSA-N |
| XLogP | 0.24 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |