C14H16O6 — CID 101403350
(2S,3R,4S,5S,6R)-2-(4-ethynylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 101403350) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(4-ethynylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(4-ethynylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 101403350 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(4-ethynylphenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C#Cc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C14H16O6/c1-2-8-3-5-9(6-4-8)19-14-13(18)12(17)11(16)10(7-15)20-14/h1,3-6,10-18H,7H2/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | BSGFMSFYFWXWQG-RKQHYHRCSA-N |
| XLogP | -1.15 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|