C14H18O6S — CID 87815655
1-[4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]oxyphenyl]ethanone (PubChem CID 87815655) has the molecular formula C14H18O6S and a molecular weight of 314.36 g/mol. Its IUPAC name is 1-[4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]oxyphenyl]ethanone.
| Compound Name | 1-[4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]oxyphenyl]ethanone |
|---|---|
| PubChem CID | 87815655 |
| Molecular Formula | C14H18O6S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-[4-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-sulfanyloxan-3-yl]oxyphenyl]ethanone |
| SMILES | CC(=O)c1ccc(O[C@@H]2[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]2S)cc1 |
| InChI | InChI=1S/C14H18O6S/c1-7(16)8-2-4-9(5-3-8)19-13-12(18)11(17)10(6-15)20-14(13)21/h2-5,10-15,17-18,21H,6H2,1H3/t10-,11+,12+,13-,14+/m1/s1 |
| InChIKey | SYIUHQQCJSLOQJ-HTOAHKCRSA-N |
| XLogP | 0.01 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|