C17H18O8 — CID 67748332
6-[(2R,3R,4S,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxynaphthalene-2-carboxylic acid (PubChem CID 67748332) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is 6-[(2R,3R,4S,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxynaphthalene-2-carboxylic acid.
| Compound Name | 6-[(2R,3R,4S,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 67748332 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 6-[(2R,3R,4S,5R,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]oxynaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cc(O[C@@H]3[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]3O)ccc2c1 |
| InChI | InChI=1S/C17H18O8/c18-7-12-13(19)14(20)15(17(23)25-12)24-11-4-3-8-5-10(16(21)22)2-1-9(8)6-11/h1-6,12-15,17-20,23H,7H2,(H,21,22)/t12-,13+,14+,15-,17-/m1/s1 |
| InChIKey | TXGGSEXVTZTFAK-RUCLQGLUSA-N |
| XLogP | -0.28 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |