C16H18O7 — CID 67748326
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(3-hydroxynaphthalen-2-yl)oxyoxane-2,4,5-triol (PubChem CID 67748326) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(3-hydroxynaphthalen-2-yl)oxyoxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(3-hydroxynaphthalen-2-yl)oxyoxane-2,4,5-triol |
|---|---|
| PubChem CID | 67748326 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(3-hydroxynaphthalen-2-yl)oxyoxane-2,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](Oc2cc3ccccc3cc2O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H18O7/c17-7-12-13(19)14(20)15(16(21)23-12)22-11-6-9-4-2-1-3-8(9)5-10(11)18/h1-6,12-21H,7H2/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | VCEZPROKFGFKCQ-IBEHDNSVSA-N |
| XLogP | -0.28 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |