C12H17NO6 — CID 67177615
(2R,3R,4S,5R,6R)-3-(2-aminophenoxy)-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 67177615) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3-(2-aminophenoxy)-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-3-(2-aminophenoxy)-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 67177615 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3-(2-aminophenoxy)-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | Nc1ccccc1O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O |
| InChI | InChI=1S/C12H17NO6/c13-6-3-1-2-4-7(6)18-11-10(16)9(15)8(5-14)19-12(11)17/h1-4,8-12,14-17H,5,13H2/t8-,9+,10+,11-,12-/m1/s1 |
| InChIKey | JHQIOKRHVIKCSE-YBXAARCKSA-N |
| XLogP | -1.55 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|