C18H18N3O10- — CID 21146519
(2S,3R,4S,5S,6R)-3-[4-(2,6-dinitroanilino)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-olate (PubChem CID 21146519) has the molecular formula C18H18N3O10- and a molecular weight of 436.35 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-3-[4-(2,6-dinitroanilino)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-olate.
| Compound Name | (2S,3R,4S,5S,6R)-3-[4-(2,6-dinitroanilino)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-olate |
|---|---|
| PubChem CID | 21146519 |
| Molecular Formula | C18H18N3O10- |
| Molecular Weight | 436.35 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (2S,3R,4S,5S,6R)-3-[4-(2,6-dinitroanilino)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-olate |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1Nc1ccc(O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2[O-])cc1 |
| InChI | InChI=1S/C18H18N3O10/c22-8-13-15(23)16(24)17(18(25)31-13)30-10-6-4-9(5-7-10)19-14-11(20(26)27)2-1-3-12(14)21(28)29/h1-7,13,15-19,22-24H,8H2/q-1/t13-,15-,16+,17-,18+/m1/s1 |
| InChIKey | JEGZKGXMBUCJKK-LHKMKVQPSA-N |
| XLogP | -0.21 |
| TPSA | 200.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.35 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|