C18H17N3O7 — CID 20849827
[3,5-bis(4-nitrophenyl)-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-7-yl]methanol (PubChem CID 20849827) has the molecular formula C18H17N3O7 and a molecular weight of 387.35 g/mol. Its IUPAC name is [3,5-bis(4-nitrophenyl)-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-7-yl]methanol.
| Compound Name | [3,5-bis(4-nitrophenyl)-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-7-yl]methanol |
|---|---|
| PubChem CID | 20849827 |
| Molecular Formula | C18H17N3O7 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [3,5-bis(4-nitrophenyl)-3,5,7,7a-tetrahydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazol-7-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc(C2OCC3C(CO)OC(c4ccc([N+](=O)[O-])cc4)N23)cc1 |
| InChI | InChI=1S/C18H17N3O7/c22-9-16-15-10-27-17(11-1-5-13(6-2-11)20(23)24)19(15)18(28-16)12-3-7-14(8-4-12)21(25)26/h1-8,15-18,22H,9-10H2 |
| InChIKey | SPYGRIMYRVWQQQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|