C16H20N2O5 — CID 101051002
[(3R,7aS)-3-(4-nitrophenyl)spiro[3,7-dihydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazole-5,1'-cyclopentane]-7a-yl]methanol (PubChem CID 101051002) has the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(3R,7aS)-3-(4-nitrophenyl)spiro[3,7-dihydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazole-5,1'-cyclopentane]-7a-yl]methanol.
| Compound Name | [(3R,7aS)-3-(4-nitrophenyl)spiro[3,7-dihydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazole-5,1'-cyclopentane]-7a-yl]methanol |
|---|---|
| PubChem CID | 101051002 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [(3R,7aS)-3-(4-nitrophenyl)spiro[3,7-dihydro-1H-[1,3]oxazolo[3,4-c][1,3]oxazole-5,1'-cyclopentane]-7a-yl]methanol |
| SMILES | O=[N+]([O-])c1ccc([C@H]2OC[C@@]3(CO)COC4(CCCC4)N23)cc1 |
| InChI | InChI=1S/C16H20N2O5/c19-9-15-10-22-14(12-3-5-13(6-4-12)18(20)21)17(15)16(23-11-15)7-1-2-8-16/h3-6,14,19H,1-2,7-11H2/t14-,15+/m1/s1 |
| InChIKey | HGMRCOLFJSUOJI-CABCVRRESA-N |
| XLogP | 1.96 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|