C26H24N2O9 — CID 11156448
(10S,14R)-10,14-bis(4-nitrophenyl)-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione (PubChem CID 11156448) has the molecular formula C26H24N2O9 and a molecular weight of 508.48 g/mol. Its IUPAC name is (10S,14R)-10,14-bis(4-nitrophenyl)-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione.
| Compound Name | (10S,14R)-10,14-bis(4-nitrophenyl)-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione |
|---|---|
| PubChem CID | 11156448 |
| Molecular Formula | C26H24N2O9 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | (10S,14R)-10,14-bis(4-nitrophenyl)-7,16-dioxadispiro[5.2.59.26]hexadecane-8,12,15-trione |
| SMILES | O=C1C[C@H](c2ccc([N+](=O)[O-])cc2)C2(C(=O)OC3(CCCCC3)OC2=O)[C@H](c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C26H24N2O9/c29-20-14-21(16-4-8-18(9-5-16)27(32)33)26(22(15-20)17-6-10-19(11-7-17)28(34)35)23(30)36-25(37-24(26)31)12-2-1-3-13-25/h4-11,21-22H,1-3,12-15H2/t21-,22+ |
| InChIKey | RMLGXPKJULFOPG-SZPZYZBQSA-N |
| XLogP | 4.48 |
| TPSA | 155.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|