C11H11NO5 — CID 161115198
methane;3-(4-nitrophenyl)oxolane-2,5-dione (PubChem CID 161115198) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is methane;3-(4-nitrophenyl)oxolane-2,5-dione.
| Compound Name | methane;3-(4-nitrophenyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 161115198 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | methane;3-(4-nitrophenyl)oxolane-2,5-dione |
| SMILES | C.O=C1CC(c2ccc([N+](=O)[O-])cc2)C(=O)O1 |
| InChI | InChI=1S/C10H7NO5.CH4/c12-9-5-8(10(13)16-9)6-1-3-7(4-2-6)11(14)15;/h1-4,8H,5H2;1H4 |
| InChIKey | UKFNSYXEAODROW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|