C22H14N4O10 — CID 98538079
(2R,6R,7R,9S,13S,14R)-7,14-bis(4-nitrophenyl)-4,11-dioxa-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 98538079) has the molecular formula C22H14N4O10 and a molecular weight of 494.37 g/mol. Its IUPAC name is (2R,6R,7R,9S,13S,14R)-7,14-bis(4-nitrophenyl)-4,11-dioxa-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | (2R,6R,7R,9S,13S,14R)-7,14-bis(4-nitrophenyl)-4,11-dioxa-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 98538079 |
| Molecular Formula | C22H14N4O10 |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | (2R,6R,7R,9S,13S,14R)-7,14-bis(4-nitrophenyl)-4,11-dioxa-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | O=C1OC(=O)[C@@H]2[C@@H]1[C@H](c1ccc([N+](=O)[O-])cc1)N1[C@H]3C(=O)OC(=O)[C@@H]3[C@H](c3ccc([N+](=O)[O-])cc3)N21 |
| InChI | InChI=1S/C22H14N4O10/c27-19-13-15(9-1-5-11(6-2-9)25(31)32)23-18-14(20(28)36-22(18)30)16(24(23)17(13)21(29)35-19)10-3-7-12(8-4-10)26(33)34/h1-8,13-18H/t13-,14+,15-,16-,17-,18+/m0/s1 |
| InChIKey | PNKQZRLRTWOQMT-ONTMVUMWSA-N |
| XLogP | 0.97 |
| TPSA | 179.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|