C22H22N4O8S2 — CID 10995070
7,14-bis(4-nitrophenyl)-4λ6,11λ6-dithia-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane 4,4,11,11-tetraoxide (PubChem CID 10995070) has the molecular formula C22H22N4O8S2 and a molecular weight of 534.57 g/mol. Its IUPAC name is 7,14-bis(4-nitrophenyl)-4λ6,11λ6-dithia-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane 4,4,11,11-tetraoxide.
| Compound Name | 7,14-bis(4-nitrophenyl)-4λ6,11λ6-dithia-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane 4,4,11,11-tetraoxide |
|---|---|
| PubChem CID | 10995070 |
| Molecular Formula | C22H22N4O8S2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | 7,14-bis(4-nitrophenyl)-4λ6,11λ6-dithia-1,8-diazatetracyclo[6.6.0.02,6.09,13]tetradecane 4,4,11,11-tetraoxide |
| SMILES | O=[N+]([O-])c1ccc(C2C3CS(=O)(=O)CC3N3C(c4ccc([N+](=O)[O-])cc4)C4CS(=O)(=O)CC4N23)cc1 |
| InChI | InChI=1S/C22H22N4O8S2/c27-25(28)15-5-1-13(2-6-15)21-17-9-35(31,32)11-19(17)24-22(14-3-7-16(8-4-14)26(29)30)18-10-36(33,34)12-20(18)23(21)24/h1-8,17-22H,9-12H2 |
| InChIKey | OHENRLYNCBZNEU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|