C10H12N2O5S — CID 18801486
(3S,4R)-4-(4-nitroanilino)-1,1-dioxothiolan-3-ol (PubChem CID 18801486) has the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. Its IUPAC name is (3S,4R)-4-(4-nitroanilino)-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4R)-4-(4-nitroanilino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 18801486 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (3S,4R)-4-(4-nitroanilino)-1,1-dioxothiolan-3-ol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H]2CS(=O)(=O)C[C@H]2O)cc1 |
| InChI | InChI=1S/C10H12N2O5S/c13-10-6-18(16,17)5-9(10)11-7-1-3-8(4-2-7)12(14)15/h1-4,9-11,13H,5-6H2/t9-,10+/m0/s1 |
| InChIKey | JALRHJXFOPEOCR-VHSXEESVSA-N |
| XLogP | 0.16 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|