C10H10N2O4S — CID 60660426
N-(4-nitrophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine (PubChem CID 60660426) has the molecular formula C10H10N2O4S and a molecular weight of 254.27 g/mol. Its IUPAC name is N-(4-nitrophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine.
| Compound Name | N-(4-nitrophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 60660426 |
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | N-(4-nitrophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| SMILES | O=[N+]([O-])c1ccc(NC2C=CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C10H10N2O4S/c13-12(14)10-3-1-8(2-4-10)11-9-5-6-17(15,16)7-9/h1-6,9,11H,7H2 |
| InChIKey | DELOBBHOFGCHPB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|