C11H13NO2S — CID 2830164
N-(3-methylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine (PubChem CID 2830164) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is N-(3-methylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine.
| Compound Name | N-(3-methylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 2830164 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | N-(3-methylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| SMILES | Cc1cccc(NC2C=CS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C11H13NO2S/c1-9-3-2-4-10(7-9)12-11-5-6-15(13,14)8-11/h2-7,11-12H,8H2,1H3 |
| InChIKey | GKKVNLXLFGUEFH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |