C10H10ClNO2S — CID 7126529
(3S)-N-(3-chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine (PubChem CID 7126529) has the molecular formula C10H10ClNO2S and a molecular weight of 243.72 g/mol. Its IUPAC name is (3S)-N-(3-chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine.
| Compound Name | (3S)-N-(3-chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 7126529 |
| Molecular Formula | C10H10ClNO2S |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | (3S)-N-(3-chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| SMILES | O=S1(=O)C=C[C@H](Nc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C10H10ClNO2S/c11-8-2-1-3-9(6-8)12-10-4-5-15(13,14)7-10/h1-6,10,12H,7H2/t10-/m0/s1 |
| InChIKey | UGUVUDMRBPYWNO-JTQLQIEISA-N |
| XLogP | 2.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |