C10H11NO3S — CID 2332882
3-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]amino]phenol (PubChem CID 2332882) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is 3-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]amino]phenol.
| Compound Name | 3-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]amino]phenol |
|---|---|
| PubChem CID | 2332882 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 3-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]amino]phenol |
| SMILES | O=S1(=O)C=C[C@@H](Nc2cccc(O)c2)C1 |
| InChI | InChI=1S/C10H11NO3S/c12-10-3-1-2-8(6-10)11-9-4-5-15(13,14)7-9/h1-6,9,11-12H,7H2/t9-/m1/s1 |
| InChIKey | CIJZCFMWVLORSF-SECBINFHSA-N |
| XLogP | 1.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |