C12H15NO2S — CID 1243726
(3S)-N-(4-ethylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine (PubChem CID 1243726) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is (3S)-N-(4-ethylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine.
| Compound Name | (3S)-N-(4-ethylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
|---|---|
| PubChem CID | 1243726 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (3S)-N-(4-ethylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| SMILES | CCc1ccc(N[C@H]2C=CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C12H15NO2S/c1-2-10-3-5-11(6-4-10)13-12-7-8-16(14,15)9-12/h3-8,12-13H,2,9H2,1H3/t12-/m0/s1 |
| InChIKey | KYUXMBQODIIOHI-LBPRGKRZSA-N |
| XLogP | 1.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |