C11H10N2O5S — CID 78910814
4-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-nitrobenzaldehyde (PubChem CID 78910814) has the molecular formula C11H10N2O5S and a molecular weight of 282.28 g/mol. Its IUPAC name is 4-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-nitrobenzaldehyde.
| Compound Name | 4-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 78910814 |
| Molecular Formula | C11H10N2O5S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 4-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]-3-nitrobenzaldehyde |
| SMILES | O=Cc1ccc(NC2C=CS(=O)(=O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10N2O5S/c14-6-8-1-2-10(11(5-8)13(15)16)12-9-3-4-19(17,18)7-9/h1-6,9,12H,7H2 |
| InChIKey | QWNZIAFDWPMLBQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|