C12H11N3O5 — CID 83109058
4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]-3-nitrobenzaldehyde (PubChem CID 83109058) has the molecular formula C12H11N3O5 and a molecular weight of 277.24 g/mol. Its IUPAC name is 4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]-3-nitrobenzaldehyde.
| Compound Name | 4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 83109058 |
| Molecular Formula | C12H11N3O5 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]-3-nitrobenzaldehyde |
| SMILES | CN1C(=O)CC(Nc2ccc(C=O)cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C12H11N3O5/c1-14-11(17)5-9(12(14)18)13-8-3-2-7(6-16)4-10(8)15(19)20/h2-4,6,9,13H,5H2,1H3 |
| InChIKey | JWJJENDUGOGZKD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|