C12H13N3O5 — CID 106257127
4-[(1-methyl-2-oxopyrrolidin-3-yl)amino]-3-nitrobenzoic acid (PubChem CID 106257127) has the molecular formula C12H13N3O5 and a molecular weight of 279.25 g/mol. Its IUPAC name is 4-[(1-methyl-2-oxopyrrolidin-3-yl)amino]-3-nitrobenzoic acid.
| Compound Name | 4-[(1-methyl-2-oxopyrrolidin-3-yl)amino]-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 106257127 |
| Molecular Formula | C12H13N3O5 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 4-[(1-methyl-2-oxopyrrolidin-3-yl)amino]-3-nitrobenzoic acid |
| SMILES | CN1CCC(Nc2ccc(C(=O)O)cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C12H13N3O5/c1-14-5-4-9(11(14)16)13-8-3-2-7(12(17)18)6-10(8)15(19)20/h2-3,6,9,13H,4-5H2,1H3,(H,17,18) |
| InChIKey | XXBQOSVUJAJHKF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|