C18H16Cl2N4O4 — CID 133439015
4-[[1-(3,4-dichlorophenyl)-2-oxopyrrolidin-3-yl]amino]-N-methyl-3-nitrobenzamide (PubChem CID 133439015) has the molecular formula C18H16Cl2N4O4 and a molecular weight of 423.26 g/mol. Its IUPAC name is 4-[[1-(3,4-dichlorophenyl)-2-oxopyrrolidin-3-yl]amino]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-[[1-(3,4-dichlorophenyl)-2-oxopyrrolidin-3-yl]amino]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 133439015 |
| Molecular Formula | C18H16Cl2N4O4 |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 4-[[1-(3,4-dichlorophenyl)-2-oxopyrrolidin-3-yl]amino]-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(NC2CCN(c3ccc(Cl)c(Cl)c3)C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16Cl2N4O4/c1-21-17(25)10-2-5-14(16(8-10)24(27)28)22-15-6-7-23(18(15)26)11-3-4-12(19)13(20)9-11/h2-5,8-9,15,22H,6-7H2,1H3,(H,21,25) |
| InChIKey | HWTWANINSHDLTL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|