C17H15Cl2N3O5S — CID 133439012
1-(3,4-dichlorophenyl)-3-(3-methylsulfonyl-4-nitroanilino)pyrrolidin-2-one (PubChem CID 133439012) has the molecular formula C17H15Cl2N3O5S and a molecular weight of 444.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(3-methylsulfonyl-4-nitroanilino)pyrrolidin-2-one.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(3-methylsulfonyl-4-nitroanilino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 133439012 |
| Molecular Formula | C17H15Cl2N3O5S |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(3-methylsulfonyl-4-nitroanilino)pyrrolidin-2-one |
| SMILES | CS(=O)(=O)c1cc(NC2CCN(c3ccc(Cl)c(Cl)c3)C2=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15Cl2N3O5S/c1-28(26,27)16-8-10(2-5-15(16)22(24)25)20-14-6-7-21(17(14)23)11-3-4-12(18)13(19)9-11/h2-5,8-9,14,20H,6-7H2,1H3 |
| InChIKey | VGOXORLQOKTPCT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|