C16H15FN2O5S — CID 133401687
6-fluoro-N-(3-methylsulfonyl-4-nitrophenyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 133401687) has the molecular formula C16H15FN2O5S and a molecular weight of 366.37 g/mol. Its IUPAC name is 6-fluoro-N-(3-methylsulfonyl-4-nitrophenyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 6-fluoro-N-(3-methylsulfonyl-4-nitrophenyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 133401687 |
| Molecular Formula | C16H15FN2O5S |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 6-fluoro-N-(3-methylsulfonyl-4-nitrophenyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CS(=O)(=O)c1cc(NC2CCOc3ccc(F)cc32)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15FN2O5S/c1-25(22,23)16-9-11(3-4-14(16)19(20)21)18-13-6-7-24-15-5-2-10(17)8-12(13)15/h2-5,8-9,13,18H,6-7H2,1H3 |
| InChIKey | INHLIKRHAPJBTG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|