C16H24N2O4S — CID 133412055
3-methylsulfonyl-4-nitro-N-(2,4,4-trimethylcyclohexyl)aniline (PubChem CID 133412055) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 3-methylsulfonyl-4-nitro-N-(2,4,4-trimethylcyclohexyl)aniline.
| Compound Name | 3-methylsulfonyl-4-nitro-N-(2,4,4-trimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 133412055 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-methylsulfonyl-4-nitro-N-(2,4,4-trimethylcyclohexyl)aniline |
| SMILES | CC1CC(C)(C)CCC1Nc1ccc([N+](=O)[O-])c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C16H24N2O4S/c1-11-10-16(2,3)8-7-13(11)17-12-5-6-14(18(19)20)15(9-12)23(4,21)22/h5-6,9,11,13,17H,7-8,10H2,1-4H3 |
| InChIKey | YALGOULDXAQYCZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|