C14H20N2O4S2 — CID 133402836
N-(2-ethylsulfanylcyclopentyl)-3-methylsulfonyl-4-nitroaniline (PubChem CID 133402836) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-(2-ethylsulfanylcyclopentyl)-3-methylsulfonyl-4-nitroaniline.
| Compound Name | N-(2-ethylsulfanylcyclopentyl)-3-methylsulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 133402836 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-(2-ethylsulfanylcyclopentyl)-3-methylsulfonyl-4-nitroaniline |
| SMILES | CCSC1CCCC1Nc1ccc([N+](=O)[O-])c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H20N2O4S2/c1-3-21-13-6-4-5-11(13)15-10-7-8-12(16(17)18)14(9-10)22(2,19)20/h7-9,11,13,15H,3-6H2,1-2H3 |
| InChIKey | QFHYSDADBXTQKV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|