C10H8F3N3O4S — CID 106749415
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine (PubChem CID 106749415) has the molecular formula C10H8F3N3O4S and a molecular weight of 323.25 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 106749415 |
| Molecular Formula | C10H8F3N3O4S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-5-nitro-2-(trifluoromethyl)pyridin-4-amine |
| SMILES | O=[N+]([O-])c1cnc(C(F)(F)F)cc1NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C10H8F3N3O4S/c11-10(12,13)9-3-7(8(4-14-9)16(17)18)15-6-1-2-21(19,20)5-6/h1-4,6H,5H2,(H,14,15) |
| InChIKey | HTKQLVDGQAWRLK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|