C34H22N8O12 — CID 3366478
4,11-bis(3-nitrophenyl)-7,14-bis(4-nitrophenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 3366478) has the molecular formula C34H22N8O12 and a molecular weight of 734.59 g/mol. Its IUPAC name is 4,11-bis(3-nitrophenyl)-7,14-bis(4-nitrophenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | 4,11-bis(3-nitrophenyl)-7,14-bis(4-nitrophenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 3366478 |
| Molecular Formula | C34H22N8O12 |
| Molecular Weight | 734.59 g/mol |
| Exact Mass | 734.14 |
| IUPAC Name | 4,11-bis(3-nitrophenyl)-7,14-bis(4-nitrophenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | O=C1C2C(C(=O)N1c1cccc([N+](=O)[O-])c1)N1C(c3ccc([N+](=O)[O-])cc3)C3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C3N1C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H22N8O12/c43-31-25-27(17-7-11-19(12-8-17)39(47)48)38-30-26(32(44)36(34(30)46)22-4-2-6-24(16-22)42(53)54)28(18-9-13-20(14-10-18)40(49)50)37(38)29(25)33(45)35(31)21-3-1-5-23(15-21)41(51)52/h1-16,25-30H |
| InChIKey | MFAHIUYUECBMCD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 253.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|