C21H19NO7 — CID 134832293
(2S)-2-(4-methoxyphenyl)-6,6-dimethyl-1-(4-nitrophenyl)-5,7-dioxaspiro[2.5]octane-4,8-dione (PubChem CID 134832293) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)-6,6-dimethyl-1-(4-nitrophenyl)-5,7-dioxaspiro[2.5]octane-4,8-dione.
| Compound Name | (2S)-2-(4-methoxyphenyl)-6,6-dimethyl-1-(4-nitrophenyl)-5,7-dioxaspiro[2.5]octane-4,8-dione |
|---|---|
| PubChem CID | 134832293 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)-6,6-dimethyl-1-(4-nitrophenyl)-5,7-dioxaspiro[2.5]octane-4,8-dione |
| SMILES | COc1ccc([C@@H]2C(c3ccc([N+](=O)[O-])cc3)C23C(=O)OC(C)(C)OC3=O)cc1 |
| InChI | InChI=1S/C21H19NO7/c1-20(2)28-18(23)21(19(24)29-20)16(12-4-8-14(9-5-12)22(25)26)17(21)13-6-10-15(27-3)11-7-13/h4-11,16-17H,1-3H3/t16?,17-/m1/s1 |
| InChIKey | RVZQRFBTZZHMFD-ZYMOGRSISA-N |
| XLogP | 3.31 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|