C23H23NO3 — CID 10089980
(1S,2R,4S,5R)-2-(4-methoxyphenyl)-3,3-dimethyl-4-(4-nitrophenyl)tricyclo[3.3.0.02,4]oct-6-ene (PubChem CID 10089980) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (1S,2R,4S,5R)-2-(4-methoxyphenyl)-3,3-dimethyl-4-(4-nitrophenyl)tricyclo[3.3.0.02,4]oct-6-ene.
| Compound Name | (1S,2R,4S,5R)-2-(4-methoxyphenyl)-3,3-dimethyl-4-(4-nitrophenyl)tricyclo[3.3.0.02,4]oct-6-ene |
|---|---|
| PubChem CID | 10089980 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (1S,2R,4S,5R)-2-(4-methoxyphenyl)-3,3-dimethyl-4-(4-nitrophenyl)tricyclo[3.3.0.02,4]oct-6-ene |
| SMILES | COc1ccc([C@@]23[C@H]4CC=C[C@H]4[C@]2(c2ccc([N+](=O)[O-])cc2)C3(C)C)cc1 |
| InChI | InChI=1S/C23H23NO3/c1-21(2)22(15-7-11-17(12-8-15)24(25)26)19-5-4-6-20(19)23(21,22)16-9-13-18(27-3)14-10-16/h4-5,7-14,19-20H,6H2,1-3H3/t19-,20+,22-,23+/m1/s1 |
| InChIKey | HBMIYHGYGFRIOP-SKWRMQMOSA-N |
| XLogP | 5.02 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|