C35H51NO3S4 — CID 88740536
5-heptyl-2-[5-heptyl-2-(4-methoxyphenyl)-1,3-dithian-2-yl]-2-(4-nitrophenyl)-1,3-dithiane (PubChem CID 88740536) has the molecular formula C35H51NO3S4 and a molecular weight of 662.07 g/mol. Its IUPAC name is 5-heptyl-2-[5-heptyl-2-(4-methoxyphenyl)-1,3-dithian-2-yl]-2-(4-nitrophenyl)-1,3-dithiane.
| Compound Name | 5-heptyl-2-[5-heptyl-2-(4-methoxyphenyl)-1,3-dithian-2-yl]-2-(4-nitrophenyl)-1,3-dithiane |
|---|---|
| PubChem CID | 88740536 |
| Molecular Formula | C35H51NO3S4 |
| Molecular Weight | 662.07 g/mol |
| Exact Mass | 661.28 |
| IUPAC Name | 5-heptyl-2-[5-heptyl-2-(4-methoxyphenyl)-1,3-dithian-2-yl]-2-(4-nitrophenyl)-1,3-dithiane |
| SMILES | CCCCCCCC1CSC(c2ccc(OC)cc2)(C2(c3ccc([N+](=O)[O-])cc3)SCC(CCCCCCC)CS2)SC1 |
| InChI | InChI=1S/C35H51NO3S4/c1-4-6-8-10-12-14-28-24-40-34(41-25-28,30-16-20-32(21-17-30)36(37)38)35(31-18-22-33(39-3)23-19-31)42-26-29(27-43-35)15-13-11-9-7-5-2/h16-23,28-29H,4-15,24-27H2,1-3H3 |
| InChIKey | UWSLKSHXECWYNH-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.07 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|