C20H19NO6 — CID 11143142
[(1R,2S,5R)-5-(4-methoxyphenyl)-1-methyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-nitrobenzoate (PubChem CID 11143142) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is [(1R,2S,5R)-5-(4-methoxyphenyl)-1-methyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-nitrobenzoate.
| Compound Name | [(1R,2S,5R)-5-(4-methoxyphenyl)-1-methyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 11143142 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [(1R,2S,5R)-5-(4-methoxyphenyl)-1-methyl-6-oxabicyclo[3.1.0]hexan-2-yl] 4-nitrobenzoate |
| SMILES | COc1ccc([C@]23CC[C@H](OC(=O)c4ccc([N+](=O)[O-])cc4)[C@@]2(C)O3)cc1 |
| InChI | InChI=1S/C20H19NO6/c1-19-17(26-18(22)13-3-7-15(8-4-13)21(23)24)11-12-20(19,27-19)14-5-9-16(25-2)10-6-14/h3-10,17H,11-12H2,1-2H3/t17-,19+,20+/m0/s1 |
| InChIKey | ZQTVUWGWVQKVNL-DFQSSKMNSA-N |
| XLogP | 3.61 |
| TPSA | 91.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|