About [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate
[(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate (PubChem CID 11567146) has the molecular formula C20H17NO7
and a molecular weight of 383.36 g/mol. Its IUPAC name is [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate.
Molecular Properties
| Compound Name | [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate |
| PubChem CID | 11567146 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@]2(c3ccc([N+](=O)[O-])cc3)C(=O)[C@H]3CCO[C@H]32)cc1 |
| InChI | InChI=1S/C20H17NO7/c1-26-15-8-2-12(3-9-15)19(23)28-20(17(22)16-10-11-27-18(16)20)13-4-6-14(7-5-13)21(24)25/h2-9,16,18H,10-11H2,1H3/t16-,18-,20-/m1/s1 |
| InChIKey | XGLOBAZIDHTZMU-YVWKXTFCSA-N |
| XLogP | 2.64 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate?
The IUPAC name of [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate (CID 11567146) is [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate.
What is the SMILES notation for [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate?
The canonical SMILES for [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate is COc1ccc(C(=O)O[C@]2(c3ccc([N+](=O)[O-])cc3)C(=O)[C@H]3CCO[C@H]32)cc1.
What is the InChIKey of [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate?
The InChIKey is XGLOBAZIDHTZMU-YVWKXTFCSA-N. The full InChI is InChI=1S/C20H17NO7/c1-26-15-8-2-12(3-9-15)19(23)28-20(17(22)16-10-11-27-18(16)20)13-4-6-14(7-5-13)21(24)25/h2-9,16,18H,10-11H2,1H3/t16-,18-,20-/m1/s1.
What are the key properties of [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate?
[(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate has a molecular weight of 383.36 g/mol, XLogP of 2.64, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,5S,7S)-7-(4-nitrophenyl)-6-oxo-2-oxabicyclo[3.2.0]heptan-7-yl] 4-methoxybenzoate is sourced from PubChem (CID 11567146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).