C26H27NO6 — CID 129440503
[(1S,2S)-2-[(2E)-2-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)ethyl]-2-methyl-3-oxocyclopentyl] 4-nitrobenzoate (PubChem CID 129440503) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is [(1S,2S)-2-[(2E)-2-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)ethyl]-2-methyl-3-oxocyclopentyl] 4-nitrobenzoate.
| Compound Name | [(1S,2S)-2-[(2E)-2-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)ethyl]-2-methyl-3-oxocyclopentyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 129440503 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | [(1S,2S)-2-[(2E)-2-(6-methoxy-3,4-dihydro-2H-naphthalen-1-ylidene)ethyl]-2-methyl-3-oxocyclopentyl] 4-nitrobenzoate |
| SMILES | COc1ccc2c(c1)CCC/C2=C\C[C@]1(C)C(=O)CC[C@@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H27NO6/c1-26(15-14-17-4-3-5-19-16-21(32-2)10-11-22(17)19)23(28)12-13-24(26)33-25(29)18-6-8-20(9-7-18)27(30)31/h6-11,14,16,24H,3-5,12-13,15H2,1-2H3/b17-14+/t24-,26+/m0/s1 |
| InChIKey | SZZGXTZWMOEKFF-TVHYMWJVSA-N |
| XLogP | 5.31 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|